C29H34N2O7 — CID 71534013
tert-butyl N-[3-(6,7,10,11-tetramethoxy-1-oxophenanthro[9,10-c]pyridin-2-yl)propyl]carbamate (PubChem CID 71534013) has the molecular formula C29H34N2O7 and a molecular weight of 522.60 g/mol. Its IUPAC name is tert-butyl N-[3-(6,7,10,11-tetramethoxy-1-oxophenanthro[9,10-c]pyridin-2-yl)propyl]carbamate.
| Compound Name | tert-butyl N-[3-(6,7,10,11-tetramethoxy-1-oxophenanthro[9,10-c]pyridin-2-yl)propyl]carbamate |
|---|---|
| PubChem CID | 71534013 |
| Molecular Formula | C29H34N2O7 |
| Molecular Weight | 522.60 g/mol |
| Exact Mass | 522.24 |
| IUPAC Name | tert-butyl N-[3-(6,7,10,11-tetramethoxy-1-oxophenanthro[9,10-c]pyridin-2-yl)propyl]carbamate |
| SMILES | COc1cc2c(cc1OC)c1ccn(CCCNC(=O)OC(C)(C)C)c(=O)c1c1cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C29H34N2O7/c1-29(2,3)38-28(33)30-10-8-11-31-12-9-17-18-13-22(34-4)23(35-5)14-19(18)20-15-24(36-6)25(37-7)16-21(20)26(17)27(31)32/h9,12-16H,8,10-11H2,1-7H3,(H,30,33) |
| InChIKey | LYMCTODKGSDVMR-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.60 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|