C22H37N3O — CID 171429427
1-[(1-tert-butylpiperidin-4-yl)methyl]-4-(2-methoxy-4-methylphenyl)piperazine (PubChem CID 171429427) has the molecular formula C22H37N3O and a molecular weight of 359.56 g/mol. Its IUPAC name is 1-[(1-tert-butylpiperidin-4-yl)methyl]-4-(2-methoxy-4-methylphenyl)piperazine.
| Compound Name | 1-[(1-tert-butylpiperidin-4-yl)methyl]-4-(2-methoxy-4-methylphenyl)piperazine |
|---|---|
| PubChem CID | 171429427 |
| Molecular Formula | C22H37N3O |
| Molecular Weight | 359.56 g/mol |
| Exact Mass | 359.29 |
| IUPAC Name | 1-[(1-tert-butylpiperidin-4-yl)methyl]-4-(2-methoxy-4-methylphenyl)piperazine |
| SMILES | COc1cc(C)ccc1N1CCN(CC2CCN(C(C)(C)C)CC2)CC1 |
| InChI | InChI=1S/C22H37N3O/c1-18-6-7-20(21(16-18)26-5)24-14-12-23(13-15-24)17-19-8-10-25(11-9-19)22(2,3)4/h6-7,16,19H,8-15,17H2,1-5H3 |
| InChIKey | YUAXEZSIJCGLTI-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.56 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |