C21H34N2 — CID 171429424
1-tert-butyl-4-[[3-(4-methylphenyl)pyrrolidin-1-yl]methyl]piperidine (PubChem CID 171429424) has the molecular formula C21H34N2 and a molecular weight of 314.52 g/mol. Its IUPAC name is 1-tert-butyl-4-[[3-(4-methylphenyl)pyrrolidin-1-yl]methyl]piperidine.
| Compound Name | 1-tert-butyl-4-[[3-(4-methylphenyl)pyrrolidin-1-yl]methyl]piperidine |
|---|---|
| PubChem CID | 171429424 |
| Molecular Formula | C21H34N2 |
| Molecular Weight | 314.52 g/mol |
| Exact Mass | 314.27 |
| IUPAC Name | 1-tert-butyl-4-[[3-(4-methylphenyl)pyrrolidin-1-yl]methyl]piperidine |
| SMILES | Cc1ccc(C2CCN(CC3CCN(C(C)(C)C)CC3)C2)cc1 |
| InChI | InChI=1S/C21H34N2/c1-17-5-7-19(8-6-17)20-11-12-22(16-20)15-18-9-13-23(14-10-18)21(2,3)4/h5-8,18,20H,9-16H2,1-4H3 |
| InChIKey | WYTKTQJUAQOERE-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.52 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |