C26H43N3 — CID 171429413
9-[(1-tert-butylpiperidin-4-yl)methyl]-3-(4-methylphenyl)-3,9-diazaspiro[5.5]undecane (PubChem CID 171429413) has the molecular formula C26H43N3 and a molecular weight of 397.65 g/mol. Its IUPAC name is 9-[(1-tert-butylpiperidin-4-yl)methyl]-3-(4-methylphenyl)-3,9-diazaspiro[5.5]undecane.
| Compound Name | 9-[(1-tert-butylpiperidin-4-yl)methyl]-3-(4-methylphenyl)-3,9-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 171429413 |
| Molecular Formula | C26H43N3 |
| Molecular Weight | 397.65 g/mol |
| Exact Mass | 397.35 |
| IUPAC Name | 9-[(1-tert-butylpiperidin-4-yl)methyl]-3-(4-methylphenyl)-3,9-diazaspiro[5.5]undecane |
| SMILES | Cc1ccc(N2CCC3(CCN(CC4CCN(C(C)(C)C)CC4)CC3)CC2)cc1 |
| InChI | InChI=1S/C26H43N3/c1-22-5-7-24(8-6-22)28-19-13-26(14-20-28)11-17-27(18-12-26)21-23-9-15-29(16-10-23)25(2,3)4/h5-8,23H,9-21H2,1-4H3 |
| InChIKey | BRGLXVZLOWUNIF-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.65 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|