C24H40N3+ — CID 174313926
9-[(1,1-dimethylpiperidin-1-ium-4-yl)methyl]-3-(4-methylphenyl)-3,9-diazaspiro[5.5]undecane (PubChem CID 174313926) has the molecular formula C24H40N3+ and a molecular weight of 370.61 g/mol. Its IUPAC name is 9-[(1,1-dimethylpiperidin-1-ium-4-yl)methyl]-3-(4-methylphenyl)-3,9-diazaspiro[5.5]undecane.
| Compound Name | 9-[(1,1-dimethylpiperidin-1-ium-4-yl)methyl]-3-(4-methylphenyl)-3,9-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 174313926 |
| Molecular Formula | C24H40N3+ |
| Molecular Weight | 370.61 g/mol |
| Exact Mass | 370.32 |
| IUPAC Name | 9-[(1,1-dimethylpiperidin-1-ium-4-yl)methyl]-3-(4-methylphenyl)-3,9-diazaspiro[5.5]undecane |
| SMILES | Cc1ccc(N2CCC3(CCN(CC4CC[N+](C)(C)CC4)CC3)CC2)cc1 |
| InChI | InChI=1S/C24H40N3/c1-21-4-6-23(7-5-21)26-16-12-24(13-17-26)10-14-25(15-11-24)20-22-8-18-27(2,3)19-9-22/h4-7,22H,8-20H2,1-3H3/q+1 |
| InChIKey | GWSUDFWVBUPYLO-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.61 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|