C21H33N5O5S — CID 19377791
tert-butyl N-[1-[4-(diaminomethylidenecarbamoyl)-5-ethyl-2-methylsulfonylphenyl]piperidin-4-yl]carbamate (PubChem CID 19377791) has the molecular formula C21H33N5O5S and a molecular weight of 467.59 g/mol. Its IUPAC name is tert-butyl N-[1-[4-(diaminomethylidenecarbamoyl)-5-ethyl-2-methylsulfonylphenyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[4-(diaminomethylidenecarbamoyl)-5-ethyl-2-methylsulfonylphenyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 19377791 |
| Molecular Formula | C21H33N5O5S |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | tert-butyl N-[1-[4-(diaminomethylidenecarbamoyl)-5-ethyl-2-methylsulfonylphenyl]piperidin-4-yl]carbamate |
| SMILES | CCc1cc(N2CCC(NC(=O)OC(C)(C)C)CC2)c(S(C)(=O)=O)cc1C(=O)N=C(N)N |
| InChI | InChI=1S/C21H33N5O5S/c1-6-13-11-16(17(32(5,29)30)12-15(13)18(27)25-19(22)23)26-9-7-14(8-10-26)24-20(28)31-21(2,3)4/h11-12,14H,6-10H2,1-5H3,(H,24,28)(H4,22,23,25,27) |
| InChIKey | MEIXHLRFZFISRK-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 157.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|