C24H30ClN5O4 — CID 19377808
tert-butyl N-[1-[2-(2-chlorophenoxy)-5-(diaminomethylidenecarbamoyl)phenyl]piperidin-4-yl]carbamate (PubChem CID 19377808) has the molecular formula C24H30ClN5O4 and a molecular weight of 487.99 g/mol. Its IUPAC name is tert-butyl N-[1-[2-(2-chlorophenoxy)-5-(diaminomethylidenecarbamoyl)phenyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[2-(2-chlorophenoxy)-5-(diaminomethylidenecarbamoyl)phenyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 19377808 |
| Molecular Formula | C24H30ClN5O4 |
| Molecular Weight | 487.99 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | tert-butyl N-[1-[2-(2-chlorophenoxy)-5-(diaminomethylidenecarbamoyl)phenyl]piperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(c2cc(C(=O)N=C(N)N)ccc2Oc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C24H30ClN5O4/c1-24(2,3)34-23(32)28-16-10-12-30(13-11-16)18-14-15(21(31)29-22(26)27)8-9-20(18)33-19-7-5-4-6-17(19)25/h4-9,14,16H,10-13H2,1-3H3,(H,28,32)(H4,26,27,29,31) |
| InChIKey | PHKXUFHDOITSDW-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 132.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.99 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|