C19H29N5O5S — CID 19377799
tert-butyl N-[1-[5-(diaminomethylidenecarbamoyl)-2-methylsulfonylphenyl]piperidin-4-yl]carbamate (PubChem CID 19377799) has the molecular formula C19H29N5O5S and a molecular weight of 439.54 g/mol. Its IUPAC name is tert-butyl N-[1-[5-(diaminomethylidenecarbamoyl)-2-methylsulfonylphenyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[5-(diaminomethylidenecarbamoyl)-2-methylsulfonylphenyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 19377799 |
| Molecular Formula | C19H29N5O5S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | tert-butyl N-[1-[5-(diaminomethylidenecarbamoyl)-2-methylsulfonylphenyl]piperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(c2cc(C(=O)N=C(N)N)ccc2S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C19H29N5O5S/c1-19(2,3)29-18(26)22-13-7-9-24(10-8-13)14-11-12(16(25)23-17(20)21)5-6-15(14)30(4,27)28/h5-6,11,13H,7-10H2,1-4H3,(H,22,26)(H4,20,21,23,25) |
| InChIKey | WISRLFXNHAKIAQ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 157.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|