C23H41N3O2 — CID 164871158
2-[4-[4-(4-amino-2-ethyl-5-methoxyphenyl)piperidin-1-yl]piperidin-1-yl]ethanol;ethane (PubChem CID 164871158) has the molecular formula C23H41N3O2 and a molecular weight of 391.60 g/mol. Its IUPAC name is 2-[4-[4-(4-amino-2-ethyl-5-methoxyphenyl)piperidin-1-yl]piperidin-1-yl]ethanol;ethane.
| Compound Name | 2-[4-[4-(4-amino-2-ethyl-5-methoxyphenyl)piperidin-1-yl]piperidin-1-yl]ethanol;ethane |
|---|---|
| PubChem CID | 164871158 |
| Molecular Formula | C23H41N3O2 |
| Molecular Weight | 391.60 g/mol |
| Exact Mass | 391.32 |
| IUPAC Name | 2-[4-[4-(4-amino-2-ethyl-5-methoxyphenyl)piperidin-1-yl]piperidin-1-yl]ethanol;ethane |
| SMILES | CC.CCc1cc(N)c(OC)cc1C1CCN(C2CCN(CCO)CC2)CC1 |
| InChI | InChI=1S/C21H35N3O2.C2H6/c1-3-16-14-20(22)21(26-2)15-19(16)17-4-10-24(11-5-17)18-6-8-23(9-7-18)12-13-25;1-2/h14-15,17-18,25H,3-13,22H2,1-2H3;1-2H3 |
| InChIKey | KQSMXAILJOPYFY-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.60 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|