C15H23FN2O3 — CID 66711213
3-[4-(4-amino-2-fluoro-5-methoxyphenyl)piperidin-1-yl]propane-1,2-diol (PubChem CID 66711213) has the molecular formula C15H23FN2O3 and a molecular weight of 298.36 g/mol. Its IUPAC name is 3-[4-(4-amino-2-fluoro-5-methoxyphenyl)piperidin-1-yl]propane-1,2-diol.
| Compound Name | 3-[4-(4-amino-2-fluoro-5-methoxyphenyl)piperidin-1-yl]propane-1,2-diol |
|---|---|
| PubChem CID | 66711213 |
| Molecular Formula | C15H23FN2O3 |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 3-[4-(4-amino-2-fluoro-5-methoxyphenyl)piperidin-1-yl]propane-1,2-diol |
| SMILES | COc1cc(C2CCN(CC(O)CO)CC2)c(F)cc1N |
| InChI | InChI=1S/C15H23FN2O3/c1-21-15-6-12(13(16)7-14(15)17)10-2-4-18(5-3-10)8-11(20)9-19/h6-7,10-11,19-20H,2-5,8-9,17H2,1H3 |
| InChIKey | FSEISWHBKUVNEQ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|