C19H32FNO3 — CID 143502107
ethane;1-[4-(2-fluoro-4-methoxy-5-methylphenyl)piperidin-1-yl]propan-1-one;methanol (PubChem CID 143502107) has the molecular formula C19H32FNO3 and a molecular weight of 341.47 g/mol. Its IUPAC name is ethane;1-[4-(2-fluoro-4-methoxy-5-methylphenyl)piperidin-1-yl]propan-1-one;methanol.
| Compound Name | ethane;1-[4-(2-fluoro-4-methoxy-5-methylphenyl)piperidin-1-yl]propan-1-one;methanol |
|---|---|
| PubChem CID | 143502107 |
| Molecular Formula | C19H32FNO3 |
| Molecular Weight | 341.47 g/mol |
| Exact Mass | 341.24 |
| IUPAC Name | ethane;1-[4-(2-fluoro-4-methoxy-5-methylphenyl)piperidin-1-yl]propan-1-one;methanol |
| SMILES | CC.CCC(=O)N1CCC(c2cc(C)c(OC)cc2F)CC1.CO |
| InChI | InChI=1S/C16H22FNO2.C2H6.CH4O/c1-4-16(19)18-7-5-12(6-8-18)13-9-11(2)15(20-3)10-14(13)17;2*1-2/h9-10,12H,4-8H2,1-3H3;1-2H3;2H,1H3 |
| InChIKey | UGUSSVLLXWTZLF-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.47 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |