C20H34FNO3 — CID 143502098
ethane;4-(2-fluoro-4-methoxy-5-methylphenyl)piperidine-1-carbaldehyde;2-methylpropan-2-ol (PubChem CID 143502098) has the molecular formula C20H34FNO3 and a molecular weight of 355.49 g/mol. Its IUPAC name is ethane;4-(2-fluoro-4-methoxy-5-methylphenyl)piperidine-1-carbaldehyde;2-methylpropan-2-ol.
| Compound Name | ethane;4-(2-fluoro-4-methoxy-5-methylphenyl)piperidine-1-carbaldehyde;2-methylpropan-2-ol |
|---|---|
| PubChem CID | 143502098 |
| Molecular Formula | C20H34FNO3 |
| Molecular Weight | 355.49 g/mol |
| Exact Mass | 355.25 |
| IUPAC Name | ethane;4-(2-fluoro-4-methoxy-5-methylphenyl)piperidine-1-carbaldehyde;2-methylpropan-2-ol |
| SMILES | CC.CC(C)(C)O.COc1cc(F)c(C2CCN(C=O)CC2)cc1C |
| InChI | InChI=1S/C14H18FNO2.C4H10O.C2H6/c1-10-7-12(13(15)8-14(10)18-2)11-3-5-16(9-17)6-4-11;1-4(2,3)5;1-2/h7-9,11H,3-6H2,1-2H3;5H,1-3H3;1-2H3 |
| InChIKey | PIPXKNFYXYFJTD-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.49 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|