C27H23ClF2N2O3 — CID 176931879
2-[4-[1-(5-chloro-2-fluoro-4-methylphenyl)piperidin-4-yl]-5-fluoro-2-methoxyphenyl]isoindole-1,3-dione (PubChem CID 176931879) has the molecular formula C27H23ClF2N2O3 and a molecular weight of 496.94 g/mol. Its IUPAC name is 2-[4-[1-(5-chloro-2-fluoro-4-methylphenyl)piperidin-4-yl]-5-fluoro-2-methoxyphenyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[1-(5-chloro-2-fluoro-4-methylphenyl)piperidin-4-yl]-5-fluoro-2-methoxyphenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 176931879 |
| Molecular Formula | C27H23ClF2N2O3 |
| Molecular Weight | 496.94 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | 2-[4-[1-(5-chloro-2-fluoro-4-methylphenyl)piperidin-4-yl]-5-fluoro-2-methoxyphenyl]isoindole-1,3-dione |
| SMILES | COc1cc(C2CCN(c3cc(Cl)c(C)cc3F)CC2)c(F)cc1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C27H23ClF2N2O3/c1-15-11-22(30)23(13-20(15)28)31-9-7-16(8-10-31)19-12-25(35-2)24(14-21(19)29)32-26(33)17-5-3-4-6-18(17)27(32)34/h3-6,11-14,16H,7-10H2,1-2H3 |
| InChIKey | WTLFHUVSDNWIIT-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.94 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|