C24H23ClFNO2S — CID 156503555
4-(4-chloro-2-fluorophenyl)-1-[2-(4-methylphenyl)sulfonylphenyl]piperidine (PubChem CID 156503555) has the molecular formula C24H23ClFNO2S and a molecular weight of 443.97 g/mol. Its IUPAC name is 4-(4-chloro-2-fluorophenyl)-1-[2-(4-methylphenyl)sulfonylphenyl]piperidine.
| Compound Name | 4-(4-chloro-2-fluorophenyl)-1-[2-(4-methylphenyl)sulfonylphenyl]piperidine |
|---|---|
| PubChem CID | 156503555 |
| Molecular Formula | C24H23ClFNO2S |
| Molecular Weight | 443.97 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | 4-(4-chloro-2-fluorophenyl)-1-[2-(4-methylphenyl)sulfonylphenyl]piperidine |
| SMILES | Cc1ccc(S(=O)(=O)c2ccccc2N2CCC(c3ccc(Cl)cc3F)CC2)cc1 |
| InChI | InChI=1S/C24H23ClFNO2S/c1-17-6-9-20(10-7-17)30(28,29)24-5-3-2-4-23(24)27-14-12-18(13-15-27)21-11-8-19(25)16-22(21)26/h2-11,16,18H,12-15H2,1H3 |
| InChIKey | OGAKJNBHSYGYJG-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.97 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |