C20H32N4O4 — CID 175428489
4-[1-(4-amino-2-ethyl-5-methoxyphenyl)piperidin-4-yl]-2-(hydroxymethyl)piperazine-1-carboxylic acid (PubChem CID 175428489) has the molecular formula C20H32N4O4 and a molecular weight of 392.50 g/mol. Its IUPAC name is 4-[1-(4-amino-2-ethyl-5-methoxyphenyl)piperidin-4-yl]-2-(hydroxymethyl)piperazine-1-carboxylic acid.
| Compound Name | 4-[1-(4-amino-2-ethyl-5-methoxyphenyl)piperidin-4-yl]-2-(hydroxymethyl)piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 175428489 |
| Molecular Formula | C20H32N4O4 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | 4-[1-(4-amino-2-ethyl-5-methoxyphenyl)piperidin-4-yl]-2-(hydroxymethyl)piperazine-1-carboxylic acid |
| SMILES | CCc1cc(N)c(OC)cc1N1CCC(N2CCN(C(=O)O)C(CO)C2)CC1 |
| InChI | InChI=1S/C20H32N4O4/c1-3-14-10-17(21)19(28-2)11-18(14)22-6-4-15(5-7-22)23-8-9-24(20(26)27)16(12-23)13-25/h10-11,15-16,25H,3-9,12-13,21H2,1-2H3,(H,26,27) |
| InChIKey | NGPMUUFDCGQBFM-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 102.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|