C23H34N6O — CID 166095449
2-methoxy-5-(1-methylpyrazol-4-yl)-4-(2-piperazin-1-yl-7-azaspiro[3.5]nonan-7-yl)aniline (PubChem CID 166095449) has the molecular formula C23H34N6O and a molecular weight of 410.57 g/mol. Its IUPAC name is 2-methoxy-5-(1-methylpyrazol-4-yl)-4-(2-piperazin-1-yl-7-azaspiro[3.5]nonan-7-yl)aniline.
| Compound Name | 2-methoxy-5-(1-methylpyrazol-4-yl)-4-(2-piperazin-1-yl-7-azaspiro[3.5]nonan-7-yl)aniline |
|---|---|
| PubChem CID | 166095449 |
| Molecular Formula | C23H34N6O |
| Molecular Weight | 410.57 g/mol |
| Exact Mass | 410.28 |
| IUPAC Name | 2-methoxy-5-(1-methylpyrazol-4-yl)-4-(2-piperazin-1-yl-7-azaspiro[3.5]nonan-7-yl)aniline |
| SMILES | COc1cc(N2CCC3(CC2)CC(N2CCNCC2)C3)c(-c2cnn(C)c2)cc1N |
| InChI | InChI=1S/C23H34N6O/c1-27-16-17(15-26-27)19-11-20(24)22(30-2)12-21(19)29-7-3-23(4-8-29)13-18(14-23)28-9-5-25-6-10-28/h11-12,15-16,18,25H,3-10,13-14,24H2,1-2H3 |
| InChIKey | HHCKNIYPLRDAHN-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 71.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.57 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|