C19H23NO3 — CID 170325130
3-[4-[2-(4-oxocyclohexyl)ethyl]phenyl]piperidine-2,6-dione (PubChem CID 170325130) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is 3-[4-[2-(4-oxocyclohexyl)ethyl]phenyl]piperidine-2,6-dione.
| Compound Name | 3-[4-[2-(4-oxocyclohexyl)ethyl]phenyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170325130 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | 3-[4-[2-(4-oxocyclohexyl)ethyl]phenyl]piperidine-2,6-dione |
| SMILES | O=C1CCC(CCc2ccc(C3CCC(=O)NC3=O)cc2)CC1 |
| InChI | InChI=1S/C19H23NO3/c21-16-9-5-14(6-10-16)2-1-13-3-7-15(8-4-13)17-11-12-18(22)20-19(17)23/h3-4,7-8,14,17H,1-2,5-6,9-12H2,(H,20,22,23) |
| InChIKey | PJMMMWIUPGSYMT-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|