C13H15AcNO2-2 — CID 176713494
actinium;ethane;3-phenylpiperidine-2,6-dione (PubChem CID 176713494) has the molecular formula C13H15AcNO2-2 and a molecular weight of 444.27 g/mol. Its IUPAC name is actinium;ethane;3-phenylpiperidine-2,6-dione.
| Compound Name | actinium;ethane;3-phenylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 176713494 |
| Molecular Formula | C13H15AcNO2-2 |
| Molecular Weight | 444.27 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | actinium;ethane;3-phenylpiperidine-2,6-dione |
| SMILES | O=C1CCC(c2cc[c-]cc2)C(=O)N1.[Ac].[CH2-]C |
| InChI | InChI=1S/C11H10NO2.C2H5.Ac/c13-10-7-6-9(11(14)12-10)8-4-2-1-3-5-8;1-2;/h2-5,9H,6-7H2,(H,12,13,14);1H2,2H3;/q2*-1; |
| InChIKey | FYXMVSAYOKVMDO-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.27 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|