C10H11N3O2 — CID 730381
(6S)-6-(4-aminophenyl)-1,3-diazinane-2,4-dione (PubChem CID 730381) has the molecular formula C10H11N3O2 and a molecular weight of 205.22 g/mol. Its IUPAC name is (6S)-6-(4-aminophenyl)-1,3-diazinane-2,4-dione.
| Compound Name | (6S)-6-(4-aminophenyl)-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 730381 |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | (6S)-6-(4-aminophenyl)-1,3-diazinane-2,4-dione |
| SMILES | Nc1ccc([C@@H]2CC(=O)NC(=O)N2)cc1 |
| InChI | InChI=1S/C10H11N3O2/c11-7-3-1-6(2-4-7)8-5-9(14)13-10(15)12-8/h1-4,8H,5,11H2,(H2,12,13,14,15)/t8-/m0/s1 |
| InChIKey | XRVGYXMTPUOWHQ-QMMMGPOBSA-N |
| XLogP | 0.54 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|