C18H16N4O2 — CID 154843184
3-[[4-(2,6-dioxo-1,3-diazinan-4-yl)anilino]methyl]benzonitrile (PubChem CID 154843184) has the molecular formula C18H16N4O2 and a molecular weight of 320.35 g/mol. Its IUPAC name is 3-[[4-(2,6-dioxo-1,3-diazinan-4-yl)anilino]methyl]benzonitrile.
| Compound Name | 3-[[4-(2,6-dioxo-1,3-diazinan-4-yl)anilino]methyl]benzonitrile |
|---|---|
| PubChem CID | 154843184 |
| Molecular Formula | C18H16N4O2 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 3-[[4-(2,6-dioxo-1,3-diazinan-4-yl)anilino]methyl]benzonitrile |
| SMILES | N#Cc1cccc(CNc2ccc(C3CC(=O)NC(=O)N3)cc2)c1 |
| InChI | InChI=1S/C18H16N4O2/c19-10-12-2-1-3-13(8-12)11-20-15-6-4-14(5-7-15)16-9-17(23)22-18(24)21-16/h1-8,16,20H,9,11H2,(H2,21,22,23,24) |
| InChIKey | NYIWMLGZIJTJIK-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 94.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |