C18H18FN3O3S — CID 78840350
3-[(4-fluoro-3-morpholin-4-ylsulfonylanilino)methyl]benzonitrile (PubChem CID 78840350) has the molecular formula C18H18FN3O3S and a molecular weight of 375.43 g/mol. Its IUPAC name is 3-[(4-fluoro-3-morpholin-4-ylsulfonylanilino)methyl]benzonitrile.
| Compound Name | 3-[(4-fluoro-3-morpholin-4-ylsulfonylanilino)methyl]benzonitrile |
|---|---|
| PubChem CID | 78840350 |
| Molecular Formula | C18H18FN3O3S |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | 3-[(4-fluoro-3-morpholin-4-ylsulfonylanilino)methyl]benzonitrile |
| SMILES | N#Cc1cccc(CNc2ccc(F)c(S(=O)(=O)N3CCOCC3)c2)c1 |
| InChI | InChI=1S/C18H18FN3O3S/c19-17-5-4-16(21-13-15-3-1-2-14(10-15)12-20)11-18(17)26(23,24)22-6-8-25-9-7-22/h1-5,10-11,21H,6-9,13H2 |
| InChIKey | RKNPHPSAKYGQSX-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |