C18H18F4N2O3S — CID 17465526
4-fluoro-3-morpholin-4-ylsulfonyl-N-[[2-(trifluoromethyl)phenyl]methyl]aniline (PubChem CID 17465526) has the molecular formula C18H18F4N2O3S and a molecular weight of 418.41 g/mol. Its IUPAC name is 4-fluoro-3-morpholin-4-ylsulfonyl-N-[[2-(trifluoromethyl)phenyl]methyl]aniline.
| Compound Name | 4-fluoro-3-morpholin-4-ylsulfonyl-N-[[2-(trifluoromethyl)phenyl]methyl]aniline |
|---|---|
| PubChem CID | 17465526 |
| Molecular Formula | C18H18F4N2O3S |
| Molecular Weight | 418.41 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | 4-fluoro-3-morpholin-4-ylsulfonyl-N-[[2-(trifluoromethyl)phenyl]methyl]aniline |
| SMILES | O=S(=O)(c1cc(NCc2ccccc2C(F)(F)F)ccc1F)N1CCOCC1 |
| InChI | InChI=1S/C18H18F4N2O3S/c19-16-6-5-14(11-17(16)28(25,26)24-7-9-27-10-8-24)23-12-13-3-1-2-4-15(13)18(20,21)22/h1-6,11,23H,7-10,12H2 |
| InChIKey | WCYCZLFMCNCVJX-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.41 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |