C12H11BN2O2 — CID 87171293
CID 87171293 (PubChem CID 87171293) has the molecular formula C12H11BN2O2 and a molecular weight of 226.04 g/mol.
| Compound Name | CID 87171293 |
|---|---|
| PubChem CID | 87171293 |
| Molecular Formula | C12H11BN2O2 |
| Molecular Weight | 226.04 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | — |
| SMILES | [B]C(=O)C1=C(C)NC(=O)CC1c1cccnc1 |
| InChI | InChI=1S/C12H11BN2O2/c1-7-11(12(13)17)9(5-10(16)15-7)8-3-2-4-14-6-8/h2-4,6,9H,5H2,1H3,(H,15,16) |
| InChIKey | XGHMLTBGZDISPH-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.04 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|