C12H9BrN2O2 — CID 171540913
2-bromo-5-(2,6-dioxopiperidin-3-yl)benzonitrile (PubChem CID 171540913) has the molecular formula C12H9BrN2O2 and a molecular weight of 293.12 g/mol. Its IUPAC name is 2-bromo-5-(2,6-dioxopiperidin-3-yl)benzonitrile.
| Compound Name | 2-bromo-5-(2,6-dioxopiperidin-3-yl)benzonitrile |
|---|---|
| PubChem CID | 171540913 |
| Molecular Formula | C12H9BrN2O2 |
| Molecular Weight | 293.12 g/mol |
| Exact Mass | 291.98 |
| IUPAC Name | 2-bromo-5-(2,6-dioxopiperidin-3-yl)benzonitrile |
| SMILES | N#Cc1cc(C2CCC(=O)NC2=O)ccc1Br |
| InChI | InChI=1S/C12H9BrN2O2/c13-10-3-1-7(5-8(10)6-14)9-2-4-11(16)15-12(9)17/h1,3,5,9H,2,4H2,(H,15,16,17) |
| InChIKey | JHVZZGCRPUCVRE-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.12 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|