C16H21FN2S — CID 103592327
3-(2,4-dimethylcyclohexyl)-6-fluoro-5-methyl-1H-benzimidazole-2-thione (PubChem CID 103592327) has the molecular formula C16H21FN2S and a molecular weight of 292.42 g/mol. Its IUPAC name is 3-(2,4-dimethylcyclohexyl)-6-fluoro-5-methyl-1H-benzimidazole-2-thione.
| Compound Name | 3-(2,4-dimethylcyclohexyl)-6-fluoro-5-methyl-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 103592327 |
| Molecular Formula | C16H21FN2S |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 3-(2,4-dimethylcyclohexyl)-6-fluoro-5-methyl-1H-benzimidazole-2-thione |
| SMILES | Cc1cc2c(cc1F)[nH]c(=S)n2C1CCC(C)CC1C |
| InChI | InChI=1S/C16H21FN2S/c1-9-4-5-14(11(3)6-9)19-15-7-10(2)12(17)8-13(15)18-16(19)20/h7-9,11,14H,4-6H2,1-3H3,(H,18,20) |
| InChIKey | NCDQUTLBIPARKM-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|