C12H13FN2OS — CID 103592407
6-fluoro-5-methyl-3-(oxolan-3-yl)-1H-benzimidazole-2-thione (PubChem CID 103592407) has the molecular formula C12H13FN2OS and a molecular weight of 252.31 g/mol. Its IUPAC name is 6-fluoro-5-methyl-3-(oxolan-3-yl)-1H-benzimidazole-2-thione.
| Compound Name | 6-fluoro-5-methyl-3-(oxolan-3-yl)-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 103592407 |
| Molecular Formula | C12H13FN2OS |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 6-fluoro-5-methyl-3-(oxolan-3-yl)-1H-benzimidazole-2-thione |
| SMILES | Cc1cc2c(cc1F)[nH]c(=S)n2C1CCOC1 |
| InChI | InChI=1S/C12H13FN2OS/c1-7-4-11-10(5-9(7)13)14-12(17)15(11)8-2-3-16-6-8/h4-5,8H,2-3,6H2,1H3,(H,14,17) |
| InChIKey | MHXLIMMBGOUWGD-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|