C15H20FN3OS — CID 103592234
N-butan-2-yl-3-(5-fluoro-6-methyl-2-sulfanylidene-3H-benzimidazol-1-yl)propanamide (PubChem CID 103592234) has the molecular formula C15H20FN3OS and a molecular weight of 309.41 g/mol. Its IUPAC name is N-butan-2-yl-3-(5-fluoro-6-methyl-2-sulfanylidene-3H-benzimidazol-1-yl)propanamide.
| Compound Name | N-butan-2-yl-3-(5-fluoro-6-methyl-2-sulfanylidene-3H-benzimidazol-1-yl)propanamide |
|---|---|
| PubChem CID | 103592234 |
| Molecular Formula | C15H20FN3OS |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | N-butan-2-yl-3-(5-fluoro-6-methyl-2-sulfanylidene-3H-benzimidazol-1-yl)propanamide |
| SMILES | CCC(C)NC(=O)CCn1c(=S)[nH]c2cc(F)c(C)cc21 |
| InChI | InChI=1S/C15H20FN3OS/c1-4-10(3)17-14(20)5-6-19-13-7-9(2)11(16)8-12(13)18-15(19)21/h7-8,10H,4-6H2,1-3H3,(H,17,20)(H,18,21) |
| InChIKey | TWWKHHQRQCEZNK-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 49.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|