C15H14FN3S — CID 103592532
6-fluoro-5-methyl-3-[(3-methyl-4-pyridinyl)methyl]-1H-benzimidazole-2-thione (PubChem CID 103592532) has the molecular formula C15H14FN3S and a molecular weight of 287.36 g/mol. Its IUPAC name is 6-fluoro-5-methyl-3-[(3-methyl-4-pyridinyl)methyl]-1H-benzimidazole-2-thione.
| Compound Name | 6-fluoro-5-methyl-3-[(3-methyl-4-pyridinyl)methyl]-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 103592532 |
| Molecular Formula | C15H14FN3S |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 6-fluoro-5-methyl-3-[(3-methyl-4-pyridinyl)methyl]-1H-benzimidazole-2-thione |
| SMILES | Cc1cc2c(cc1F)[nH]c(=S)n2Cc1ccncc1C |
| InChI | InChI=1S/C15H14FN3S/c1-9-5-14-13(6-12(9)16)18-15(20)19(14)8-11-3-4-17-7-10(11)2/h3-7H,8H2,1-2H3,(H,18,20) |
| InChIKey | WGQLRVBZFSLQQJ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|