C16H20N2S — CID 107850907
3-[2-(cyclohexen-1-yl)ethyl]-6-methyl-1H-benzimidazole-2-thione (PubChem CID 107850907) has the molecular formula C16H20N2S and a molecular weight of 272.42 g/mol. Its IUPAC name is 3-[2-(cyclohexen-1-yl)ethyl]-6-methyl-1H-benzimidazole-2-thione.
| Compound Name | 3-[2-(cyclohexen-1-yl)ethyl]-6-methyl-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 107850907 |
| Molecular Formula | C16H20N2S |
| Molecular Weight | 272.42 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 3-[2-(cyclohexen-1-yl)ethyl]-6-methyl-1H-benzimidazole-2-thione |
| SMILES | Cc1ccc2c(c1)[nH]c(=S)n2CCC1=CCCCC1 |
| InChI | InChI=1S/C16H20N2S/c1-12-7-8-15-14(11-12)17-16(19)18(15)10-9-13-5-3-2-4-6-13/h5,7-8,11H,2-4,6,9-10H2,1H3,(H,17,19) |
| InChIKey | SVSRTTRFSUXPSL-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.42 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|