C15H17ClN2S — CID 107850927
4-chloro-3-[2-(cyclohexen-1-yl)ethyl]-1H-benzimidazole-2-thione (PubChem CID 107850927) has the molecular formula C15H17ClN2S and a molecular weight of 292.83 g/mol. Its IUPAC name is 4-chloro-3-[2-(cyclohexen-1-yl)ethyl]-1H-benzimidazole-2-thione.
| Compound Name | 4-chloro-3-[2-(cyclohexen-1-yl)ethyl]-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 107850927 |
| Molecular Formula | C15H17ClN2S |
| Molecular Weight | 292.83 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 4-chloro-3-[2-(cyclohexen-1-yl)ethyl]-1H-benzimidazole-2-thione |
| SMILES | S=c1[nH]c2cccc(Cl)c2n1CCC1=CCCCC1 |
| InChI | InChI=1S/C15H17ClN2S/c16-12-7-4-8-13-14(12)18(15(19)17-13)10-9-11-5-2-1-3-6-11/h4-5,7-8H,1-3,6,9-10H2,(H,17,19) |
| InChIKey | KHRPMSMEVHLECP-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.83 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|