C12H11ClN4OS — CID 106419426
4-chloro-3-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]-1H-benzimidazole-2-thione (PubChem CID 106419426) has the molecular formula C12H11ClN4OS and a molecular weight of 294.77 g/mol. Its IUPAC name is 4-chloro-3-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]-1H-benzimidazole-2-thione.
| Compound Name | 4-chloro-3-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 106419426 |
| Molecular Formula | C12H11ClN4OS |
| Molecular Weight | 294.77 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | 4-chloro-3-[2-(5-methyl-1,2,4-oxadiazol-3-yl)ethyl]-1H-benzimidazole-2-thione |
| SMILES | Cc1nc(CCn2c(=S)[nH]c3cccc(Cl)c32)no1 |
| InChI | InChI=1S/C12H11ClN4OS/c1-7-14-10(16-18-7)5-6-17-11-8(13)3-2-4-9(11)15-12(17)19/h2-4H,5-6H2,1H3,(H,15,19) |
| InChIKey | XMQXCWVUQXDMTA-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.77 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|