C11H10N4OS — CID 106405394
3-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-1H-benzimidazole-2-thione (PubChem CID 106405394) has the molecular formula C11H10N4OS and a molecular weight of 246.29 g/mol. Its IUPAC name is 3-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-1H-benzimidazole-2-thione.
| Compound Name | 3-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 106405394 |
| Molecular Formula | C11H10N4OS |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 3-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]-1H-benzimidazole-2-thione |
| SMILES | Cc1nc(Cn2c(=S)[nH]c3ccccc32)no1 |
| InChI | InChI=1S/C11H10N4OS/c1-7-12-10(14-16-7)6-15-9-5-3-2-4-8(9)13-11(15)17/h2-5H,6H2,1H3,(H,13,17) |
| InChIKey | AKHVFYKSBZKRSV-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|