C13H14N4S — CID 114139016
3-[(1,5-dimethylpyrazol-4-yl)methyl]-1H-benzimidazole-2-thione (PubChem CID 114139016) has the molecular formula C13H14N4S and a molecular weight of 258.35 g/mol. Its IUPAC name is 3-[(1,5-dimethylpyrazol-4-yl)methyl]-1H-benzimidazole-2-thione.
| Compound Name | 3-[(1,5-dimethylpyrazol-4-yl)methyl]-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 114139016 |
| Molecular Formula | C13H14N4S |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 3-[(1,5-dimethylpyrazol-4-yl)methyl]-1H-benzimidazole-2-thione |
| SMILES | Cc1c(Cn2c(=S)[nH]c3ccccc32)cnn1C |
| InChI | InChI=1S/C13H14N4S/c1-9-10(7-14-16(9)2)8-17-12-6-4-3-5-11(12)15-13(17)18/h3-7H,8H2,1-2H3,(H,15,18) |
| InChIKey | GUFIBCINNKALPG-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 38.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|