C13H14N6S — CID 106033855
4-[(1,5-dimethylpyrazol-4-yl)methyl]-3-pyridin-3-yl-1H-1,2,4-triazole-5-thione (PubChem CID 106033855) has the molecular formula C13H14N6S and a molecular weight of 286.36 g/mol. Its IUPAC name is 4-[(1,5-dimethylpyrazol-4-yl)methyl]-3-pyridin-3-yl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(1,5-dimethylpyrazol-4-yl)methyl]-3-pyridin-3-yl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 106033855 |
| Molecular Formula | C13H14N6S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 4-[(1,5-dimethylpyrazol-4-yl)methyl]-3-pyridin-3-yl-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1c(Cn2c(-c3cccnc3)n[nH]c2=S)cnn1C |
| InChI | InChI=1S/C13H14N6S/c1-9-11(7-15-18(9)2)8-19-12(16-17-13(19)20)10-4-3-5-14-6-10/h3-7H,8H2,1-2H3,(H,17,20) |
| InChIKey | RJPRHJCDBLQAFC-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 64.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|