C13H13N3S2 — CID 107297112
2-sulfanylidene-3-(thiolan-3-ylmethyl)-1H-benzimidazole-5-carbonitrile (PubChem CID 107297112) has the molecular formula C13H13N3S2 and a molecular weight of 275.40 g/mol. Its IUPAC name is 2-sulfanylidene-3-(thiolan-3-ylmethyl)-1H-benzimidazole-5-carbonitrile.
| Compound Name | 2-sulfanylidene-3-(thiolan-3-ylmethyl)-1H-benzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 107297112 |
| Molecular Formula | C13H13N3S2 |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 2-sulfanylidene-3-(thiolan-3-ylmethyl)-1H-benzimidazole-5-carbonitrile |
| SMILES | N#Cc1ccc2[nH]c(=S)n(CC3CCSC3)c2c1 |
| InChI | InChI=1S/C13H13N3S2/c14-6-9-1-2-11-12(5-9)16(13(17)15-11)7-10-3-4-18-8-10/h1-2,5,10H,3-4,7-8H2,(H,15,17) |
| InChIKey | KJOOWQZGJLJDKH-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 44.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|