C14H15ClN2O3S — CID 62131284
2-(chloromethyl)-3-[(1,1-dioxothiolan-3-yl)methyl]quinazolin-4-one (PubChem CID 62131284) has the molecular formula C14H15ClN2O3S and a molecular weight of 326.81 g/mol. Its IUPAC name is 2-(chloromethyl)-3-[(1,1-dioxothiolan-3-yl)methyl]quinazolin-4-one.
| Compound Name | 2-(chloromethyl)-3-[(1,1-dioxothiolan-3-yl)methyl]quinazolin-4-one |
|---|---|
| PubChem CID | 62131284 |
| Molecular Formula | C14H15ClN2O3S |
| Molecular Weight | 326.81 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 2-(chloromethyl)-3-[(1,1-dioxothiolan-3-yl)methyl]quinazolin-4-one |
| SMILES | O=c1c2ccccc2nc(CCl)n1CC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H15ClN2O3S/c15-7-13-16-12-4-2-1-3-11(12)14(18)17(13)8-10-5-6-21(19,20)9-10/h1-4,10H,5-9H2 |
| InChIKey | HVBMTSKLYPCONO-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 69.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.81 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|