C16H20ClN3O — CID 114505858
2-(chloromethyl)-3-(1,3-dimethylpiperidin-4-yl)quinazolin-4-one (PubChem CID 114505858) has the molecular formula C16H20ClN3O and a molecular weight of 305.81 g/mol. Its IUPAC name is 2-(chloromethyl)-3-(1,3-dimethylpiperidin-4-yl)quinazolin-4-one.
| Compound Name | 2-(chloromethyl)-3-(1,3-dimethylpiperidin-4-yl)quinazolin-4-one |
|---|---|
| PubChem CID | 114505858 |
| Molecular Formula | C16H20ClN3O |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 2-(chloromethyl)-3-(1,3-dimethylpiperidin-4-yl)quinazolin-4-one |
| SMILES | CC1CN(C)CCC1n1c(CCl)nc2ccccc2c1=O |
| InChI | InChI=1S/C16H20ClN3O/c1-11-10-19(2)8-7-14(11)20-15(9-17)18-13-6-4-3-5-12(13)16(20)21/h3-6,11,14H,7-10H2,1-2H3 |
| InChIKey | HGKNEVHCWRZYMK-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|