C15H14ClN3 — CID 103964688
2-(chloromethyl)-1-(2-methylcyclopropyl)imidazo[4,5-c]quinoline (PubChem CID 103964688) has the molecular formula C15H14ClN3 and a molecular weight of 271.75 g/mol. Its IUPAC name is 2-(chloromethyl)-1-(2-methylcyclopropyl)imidazo[4,5-c]quinoline.
| Compound Name | 2-(chloromethyl)-1-(2-methylcyclopropyl)imidazo[4,5-c]quinoline |
|---|---|
| PubChem CID | 103964688 |
| Molecular Formula | C15H14ClN3 |
| Molecular Weight | 271.75 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 2-(chloromethyl)-1-(2-methylcyclopropyl)imidazo[4,5-c]quinoline |
| SMILES | CC1CC1n1c(CCl)nc2cnc3ccccc3c21 |
| InChI | InChI=1S/C15H14ClN3/c1-9-6-13(9)19-14(7-16)18-12-8-17-11-5-3-2-4-10(11)15(12)19/h2-5,8-9,13H,6-7H2,1H3 |
| InChIKey | PFLIYWYZQRGZFQ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.75 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|