C16H19N5 — CID 103964413
1-(1-methylpiperidin-4-yl)imidazo[4,5-c]quinolin-2-amine (PubChem CID 103964413) has the molecular formula C16H19N5 and a molecular weight of 281.36 g/mol. Its IUPAC name is 1-(1-methylpiperidin-4-yl)imidazo[4,5-c]quinolin-2-amine.
| Compound Name | 1-(1-methylpiperidin-4-yl)imidazo[4,5-c]quinolin-2-amine |
|---|---|
| PubChem CID | 103964413 |
| Molecular Formula | C16H19N5 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 1-(1-methylpiperidin-4-yl)imidazo[4,5-c]quinolin-2-amine |
| SMILES | CN1CCC(n2c(N)nc3cnc4ccccc4c32)CC1 |
| InChI | InChI=1S/C16H19N5/c1-20-8-6-11(7-9-20)21-15-12-4-2-3-5-13(12)18-10-14(15)19-16(21)17/h2-5,10-11H,6-9H2,1H3,(H2,17,19) |
| InChIKey | POIYYKDPXDJSNI-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |