C15H16N4S — CID 103964222
1-(1-methylpyrrolidin-3-yl)-3H-imidazo[4,5-c]quinoline-2-thione (PubChem CID 103964222) has the molecular formula C15H16N4S and a molecular weight of 284.39 g/mol. Its IUPAC name is 1-(1-methylpyrrolidin-3-yl)-3H-imidazo[4,5-c]quinoline-2-thione.
| Compound Name | 1-(1-methylpyrrolidin-3-yl)-3H-imidazo[4,5-c]quinoline-2-thione |
|---|---|
| PubChem CID | 103964222 |
| Molecular Formula | C15H16N4S |
| Molecular Weight | 284.39 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 1-(1-methylpyrrolidin-3-yl)-3H-imidazo[4,5-c]quinoline-2-thione |
| SMILES | CN1CCC(n2c(=S)[nH]c3cnc4ccccc4c32)C1 |
| InChI | InChI=1S/C15H16N4S/c1-18-7-6-10(9-18)19-14-11-4-2-3-5-12(11)16-8-13(14)17-15(19)20/h2-5,8,10H,6-7,9H2,1H3,(H,17,20) |
| InChIKey | LQPQCNZBPDOVGY-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 36.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.39 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|