C17H19N3S — CID 103964312
1-(2,3-dimethylcyclopentyl)-3H-imidazo[4,5-c]quinoline-2-thione (PubChem CID 103964312) has the molecular formula C17H19N3S and a molecular weight of 297.43 g/mol. Its IUPAC name is 1-(2,3-dimethylcyclopentyl)-3H-imidazo[4,5-c]quinoline-2-thione.
| Compound Name | 1-(2,3-dimethylcyclopentyl)-3H-imidazo[4,5-c]quinoline-2-thione |
|---|---|
| PubChem CID | 103964312 |
| Molecular Formula | C17H19N3S |
| Molecular Weight | 297.43 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 1-(2,3-dimethylcyclopentyl)-3H-imidazo[4,5-c]quinoline-2-thione |
| SMILES | CC1CCC(n2c(=S)[nH]c3cnc4ccccc4c32)C1C |
| InChI | InChI=1S/C17H19N3S/c1-10-7-8-15(11(10)2)20-16-12-5-3-4-6-13(12)18-9-14(16)19-17(20)21/h3-6,9-11,15H,7-8H2,1-2H3,(H,19,21) |
| InChIKey | GAEVMRCNRIVCGS-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.43 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|