C12H9F3N4 — CID 103964365
1-(2,2,2-trifluoroethyl)imidazo[4,5-c]quinolin-2-amine (PubChem CID 103964365) has the molecular formula C12H9F3N4 and a molecular weight of 266.23 g/mol. Its IUPAC name is 1-(2,2,2-trifluoroethyl)imidazo[4,5-c]quinolin-2-amine.
| Compound Name | 1-(2,2,2-trifluoroethyl)imidazo[4,5-c]quinolin-2-amine |
|---|---|
| PubChem CID | 103964365 |
| Molecular Formula | C12H9F3N4 |
| Molecular Weight | 266.23 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 1-(2,2,2-trifluoroethyl)imidazo[4,5-c]quinolin-2-amine |
| SMILES | Nc1nc2cnc3ccccc3c2n1CC(F)(F)F |
| InChI | InChI=1S/C12H9F3N4/c13-12(14,15)6-19-10-7-3-1-2-4-8(7)17-5-9(10)18-11(19)16/h1-5H,6H2,(H2,16,18) |
| InChIKey | DYPYYTZLKLSHDO-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.23 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |