C16H18N4O — CID 103964539
1-[(2-methyloxolan-2-yl)methyl]imidazo[4,5-c]quinolin-2-amine (PubChem CID 103964539) has the molecular formula C16H18N4O and a molecular weight of 282.35 g/mol. Its IUPAC name is 1-[(2-methyloxolan-2-yl)methyl]imidazo[4,5-c]quinolin-2-amine.
| Compound Name | 1-[(2-methyloxolan-2-yl)methyl]imidazo[4,5-c]quinolin-2-amine |
|---|---|
| PubChem CID | 103964539 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 1-[(2-methyloxolan-2-yl)methyl]imidazo[4,5-c]quinolin-2-amine |
| SMILES | CC1(Cn2c(N)nc3cnc4ccccc4c32)CCCO1 |
| InChI | InChI=1S/C16H18N4O/c1-16(7-4-8-21-16)10-20-14-11-5-2-3-6-12(11)18-9-13(14)19-15(20)17/h2-3,5-6,9H,4,7-8,10H2,1H3,(H2,17,19) |
| InChIKey | PYRFARSGLKHQQY-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |