C16H18N4O — CID 103964484
2-(2-aminoimidazo[4,5-c]quinolin-1-yl)cyclohexan-1-ol (PubChem CID 103964484) has the molecular formula C16H18N4O and a molecular weight of 282.35 g/mol. Its IUPAC name is 2-(2-aminoimidazo[4,5-c]quinolin-1-yl)cyclohexan-1-ol.
| Compound Name | 2-(2-aminoimidazo[4,5-c]quinolin-1-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 103964484 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 2-(2-aminoimidazo[4,5-c]quinolin-1-yl)cyclohexan-1-ol |
| SMILES | Nc1nc2cnc3ccccc3c2n1C1CCCCC1O |
| InChI | InChI=1S/C16H18N4O/c17-16-19-12-9-18-11-6-2-1-5-10(11)15(12)20(16)13-7-3-4-8-14(13)21/h1-2,5-6,9,13-14,21H,3-4,7-8H2,(H2,17,19) |
| InChIKey | CAGBGVJOGPYIBX-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |