C16H18ClN3S — CID 103964705
2-(chloromethyl)-1-(2-methyl-3-methylsulfanylpropyl)imidazo[4,5-c]quinoline (PubChem CID 103964705) has the molecular formula C16H18ClN3S and a molecular weight of 319.86 g/mol. Its IUPAC name is 2-(chloromethyl)-1-(2-methyl-3-methylsulfanylpropyl)imidazo[4,5-c]quinoline.
| Compound Name | 2-(chloromethyl)-1-(2-methyl-3-methylsulfanylpropyl)imidazo[4,5-c]quinoline |
|---|---|
| PubChem CID | 103964705 |
| Molecular Formula | C16H18ClN3S |
| Molecular Weight | 319.86 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 2-(chloromethyl)-1-(2-methyl-3-methylsulfanylpropyl)imidazo[4,5-c]quinoline |
| SMILES | CSCC(C)Cn1c(CCl)nc2cnc3ccccc3c21 |
| InChI | InChI=1S/C16H18ClN3S/c1-11(10-21-2)9-20-15(7-17)19-14-8-18-13-6-4-3-5-12(13)16(14)20/h3-6,8,11H,7,9-10H2,1-2H3 |
| InChIKey | JJVQAIZZGWITNE-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.86 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|