C13H18ClN3S — CID 81135418
2-(chloromethyl)-5-methyl-3-(2-methyl-3-methylsulfanylpropyl)imidazo[4,5-b]pyridine (PubChem CID 81135418) has the molecular formula C13H18ClN3S and a molecular weight of 283.83 g/mol. Its IUPAC name is 2-(chloromethyl)-5-methyl-3-(2-methyl-3-methylsulfanylpropyl)imidazo[4,5-b]pyridine.
| Compound Name | 2-(chloromethyl)-5-methyl-3-(2-methyl-3-methylsulfanylpropyl)imidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 81135418 |
| Molecular Formula | C13H18ClN3S |
| Molecular Weight | 283.83 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 2-(chloromethyl)-5-methyl-3-(2-methyl-3-methylsulfanylpropyl)imidazo[4,5-b]pyridine |
| SMILES | CSCC(C)Cn1c(CCl)nc2ccc(C)nc21 |
| InChI | InChI=1S/C13H18ClN3S/c1-9(8-18-3)7-17-12(6-14)16-11-5-4-10(2)15-13(11)17/h4-5,9H,6-8H2,1-3H3 |
| InChIKey | FKRCDKSENGZDPL-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.83 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|