C16H22ClN3O — CID 114505115
2-(chloromethyl)-1-(1,3-dimethylpiperidin-4-yl)-5-methoxybenzimidazole (PubChem CID 114505115) has the molecular formula C16H22ClN3O and a molecular weight of 307.82 g/mol. Its IUPAC name is 2-(chloromethyl)-1-(1,3-dimethylpiperidin-4-yl)-5-methoxybenzimidazole.
| Compound Name | 2-(chloromethyl)-1-(1,3-dimethylpiperidin-4-yl)-5-methoxybenzimidazole |
|---|---|
| PubChem CID | 114505115 |
| Molecular Formula | C16H22ClN3O |
| Molecular Weight | 307.82 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 2-(chloromethyl)-1-(1,3-dimethylpiperidin-4-yl)-5-methoxybenzimidazole |
| SMILES | COc1ccc2c(c1)nc(CCl)n2C1CCN(C)CC1C |
| InChI | InChI=1S/C16H22ClN3O/c1-11-10-19(2)7-6-14(11)20-15-5-4-12(21-3)8-13(15)18-16(20)9-17/h4-5,8,11,14H,6-7,9-10H2,1-3H3 |
| InChIKey | RFFPDSMYORMXDE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.82 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|