C15H20BrFN4 — CID 66088828
5-bromo-1-[(1-ethylpiperidin-4-yl)methyl]-6-fluorobenzimidazol-2-amine (PubChem CID 66088828) has the molecular formula C15H20BrFN4 and a molecular weight of 355.26 g/mol. Its IUPAC name is 5-bromo-1-[(1-ethylpiperidin-4-yl)methyl]-6-fluorobenzimidazol-2-amine.
| Compound Name | 5-bromo-1-[(1-ethylpiperidin-4-yl)methyl]-6-fluorobenzimidazol-2-amine |
|---|---|
| PubChem CID | 66088828 |
| Molecular Formula | C15H20BrFN4 |
| Molecular Weight | 355.26 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 5-bromo-1-[(1-ethylpiperidin-4-yl)methyl]-6-fluorobenzimidazol-2-amine |
| SMILES | CCN1CCC(Cn2c(N)nc3cc(Br)c(F)cc32)CC1 |
| InChI | InChI=1S/C15H20BrFN4/c1-2-20-5-3-10(4-6-20)9-21-14-8-12(17)11(16)7-13(14)19-15(21)18/h7-8,10H,2-6,9H2,1H3,(H2,18,19) |
| InChIKey | AUCQMTCLBZIJLV-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.26 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |