C13H15BrFN3S — CID 80612265
5-bromo-6-fluoro-1-(thian-2-ylmethyl)benzimidazol-2-amine (PubChem CID 80612265) has the molecular formula C13H15BrFN3S and a molecular weight of 344.25 g/mol. Its IUPAC name is 5-bromo-6-fluoro-1-(thian-2-ylmethyl)benzimidazol-2-amine.
| Compound Name | 5-bromo-6-fluoro-1-(thian-2-ylmethyl)benzimidazol-2-amine |
|---|---|
| PubChem CID | 80612265 |
| Molecular Formula | C13H15BrFN3S |
| Molecular Weight | 344.25 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | 5-bromo-6-fluoro-1-(thian-2-ylmethyl)benzimidazol-2-amine |
| SMILES | Nc1nc2cc(Br)c(F)cc2n1CC1CCCCS1 |
| InChI | InChI=1S/C13H15BrFN3S/c14-9-5-11-12(6-10(9)15)18(13(16)17-11)7-8-3-1-2-4-19-8/h5-6,8H,1-4,7H2,(H2,16,17) |
| InChIKey | UXFKCAFTIWNWPE-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.25 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |