C15H21N3O2S — CID 83003474
5,6-dimethoxy-1-(thian-2-ylmethyl)benzimidazol-2-amine (PubChem CID 83003474) has the molecular formula C15H21N3O2S and a molecular weight of 307.42 g/mol. Its IUPAC name is 5,6-dimethoxy-1-(thian-2-ylmethyl)benzimidazol-2-amine.
| Compound Name | 5,6-dimethoxy-1-(thian-2-ylmethyl)benzimidazol-2-amine |
|---|---|
| PubChem CID | 83003474 |
| Molecular Formula | C15H21N3O2S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 5,6-dimethoxy-1-(thian-2-ylmethyl)benzimidazol-2-amine |
| SMILES | COc1cc2nc(N)n(CC3CCCCS3)c2cc1OC |
| InChI | InChI=1S/C15H21N3O2S/c1-19-13-7-11-12(8-14(13)20-2)18(15(16)17-11)9-10-5-3-4-6-21-10/h7-8,10H,3-6,9H2,1-2H3,(H2,16,17) |
| InChIKey | OSKMTPIVZRHMOV-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |